CAS 1011244-72-6 appears in our catalog under these names: 4-Amino-n-(4-trifluoromethylphenyl)benzamide, 95%, Teriflunomide Impurity 4, Teriflunomide impurity 3, Teriflunomide impurity 3/ 99.62% (existing batch purity), 4-Amino-N-(4-(trifluoromethyl)phenyl) benzamide. Offered by: Combi-blocks, Chemat Brand, GLPBio, TargetMol, Biosynth. Available pack sizes: 250mg, on request, 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg.
4-amino-N-[4-(trifluoromethyl)phenyl]benzamide (CAS 1011244-72-6) is a chemical compound with the molecular formula C14H11F3N2O and a molecular weight of 280.24 g/mol. IUPAC name: 4-amino-N-[4-(trifluoromethyl)phenyl]benzamide. InChIKey: YUWBBWHECQSIKL-UHFFFAOYSA-N.
| Molecular formula | C14H11F3N2O |
|---|---|
| Molecular weight | 280.24 g/mol |
| IUPAC name | 4-amino-N-[4-(trifluoromethyl)phenyl]benzamide |
| InChIKey | YUWBBWHECQSIKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)