Products 926663-69-6
CAS 926663-69-6 appears in our catalog under these names: N-(3-Aminophenyl)-3-(trifluoromethyl)benzamide, 95%, N-(3-Aminophenyl)-3-(trifluoromethyl)benzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
N-(3-aminophenyl)-3-(trifluoromethyl)benzamide (CAS 926663-69-6) is a chemical compound with the molecular formula C14H11F3N2O and a molecular weight of 280.24 g/mol. IUPAC name: N-(3-aminophenyl)-3-(trifluoromethyl)benzamide. InChIKey: OXTAWUMXNUGWMT-UHFFFAOYSA-N.
| Molecular formula | C14H11F3N2O |
|---|---|
| Molecular weight | 280.24 g/mol |
| IUPAC name | N-(3-aminophenyl)-3-(trifluoromethyl)benzamide |
| InChIKey | OXTAWUMXNUGWMT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=O)NC2=CC=CC(=C2)N |
Computed by PubChem (NCBI)