CAS 1011399-89-5 is the registry number for 5-Chloro-1-(4-fluorophenyl)-3,6-dimethyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-chloro-1-(4-fluorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid (CAS 1011399-89-5) is a chemical compound with the molecular formula C15H11ClFN3O2 and a molecular weight of 319.72 g/mol. IUPAC name: 5-chloro-1-(4-fluorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid. InChIKey: WUHLZIPBRIHJET-UHFFFAOYSA-N.
| Molecular formula | C15H11ClFN3O2 |
|---|---|
| Molecular weight | 319.72 g/mol |
| IUPAC name | 5-chloro-1-(4-fluorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid |
| InChIKey | WUHLZIPBRIHJET-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=NN(C2=N1)C3=CC=C(C=C3)F)C)C(=O)O)Cl |
Computed by PubChem (NCBI)