Products 451494-91-0
CAS 451494-91-0 appears in our catalog under these names: 4-((3-Chloro-4-fluorophenyl)amino)-6-methoxyquinazolin-7-ol 95%, 4-((3-Chloro-4-fluorophenyl)amino)-6-methoxyquinazolin-7-ol, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(3-chloro-4-fluoroanilino)-6-methoxyquinazolin-7-ol (CAS 451494-91-0) is a chemical compound with the molecular formula C15H11ClFN3O2 and a molecular weight of 319.72 g/mol. IUPAC name: 4-(3-chloro-4-fluoroanilino)-6-methoxyquinazolin-7-ol. InChIKey: HIJHWRQHYCERSH-UHFFFAOYSA-N.
| Molecular formula | C15H11ClFN3O2 |
|---|---|
| Molecular weight | 319.72 g/mol |
| IUPAC name | 4-(3-chloro-4-fluoroanilino)-6-methoxyquinazolin-7-ol |
| InChIKey | HIJHWRQHYCERSH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)O |
Computed by PubChem (NCBI)