Products 1228665-04-0
CAS 1228665-04-0 is the registry number for 4-((3-Chloro-4-fluorophenyl)amino)-7-(methoxy-D3)quinazolin-6-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(3-chloro-4-fluoroanilino)-7-(trideuteriomethoxy)quinazolin-6-ol (CAS 1228665-04-0) is a chemical compound with the molecular formula C15H11ClFN3O2 and a molecular weight of 322.73 g/mol. IUPAC name: 4-(3-chloro-4-fluoroanilino)-7-(trideuteriomethoxy)quinazolin-6-ol. InChIKey: JLVTVCRXFMLUIF-FIBGUPNXSA-N.
| Molecular formula | C15H11ClFN3O2 |
|---|---|
| Molecular weight | 322.73 g/mol |
| IUPAC name | 4-(3-chloro-4-fluoroanilino)-7-(trideuteriomethoxy)quinazolin-6-ol |
| InChIKey | JLVTVCRXFMLUIF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)O |
Computed by PubChem (NCBI)