CAS 1011405-01-8 is the registry number for Potassium 2-(1h-1,3-benzodiazol-1-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
Potassium 2-(benzimidazol-1-yl)acetate (CAS 1011405-01-8) is a chemical compound with the molecular formula C9H7KN2O2 and a molecular weight of 214.26 g/mol. IUPAC name: potassium 2-(benzimidazol-1-yl)acetate. InChIKey: RAELREWAAVBWPM-UHFFFAOYSA-M.
| Molecular formula | C9H7KN2O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | potassium 2-(benzimidazol-1-yl)acetate |
| InChIKey | RAELREWAAVBWPM-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)N=CN2CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)