CAS 50909-46-1 appears in our catalog under these names: Potassium benzyl cyanocarbamate, 95%, Potassium benzyl cyanocarbamate, POTASSIUM BENZYL CYANOCARBAMATE. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 1g.
Potassium cyano(phenylmethoxycarbonyl)azanide (CAS 50909-46-1) is a chemical compound with the molecular formula C9H7KN2O2 and a molecular weight of 214.26 g/mol. IUPAC name: potassium cyano(phenylmethoxycarbonyl)azanide. InChIKey: HZBHQPNPJVDRMR-UHFFFAOYSA-M.
| Molecular formula | C9H7KN2O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | potassium cyano(phenylmethoxycarbonyl)azanide |
| InChIKey | HZBHQPNPJVDRMR-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)COC(=O)[N-]C#N.[K+] |
Computed by PubChem (NCBI)