CAS 1011426-50-8 appears in our catalog under these names: Sodium 2-(2-(3-methoxyphenyl)-1,3-thiazol-4-yl)acetate, 95%, Sodium 2-(2-(3-methoxyphenyl)-1,3-thiazol-4-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Sodium 2-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]acetate (CAS 1011426-50-8) is a chemical compound with the molecular formula C12H10NNaO3S and a molecular weight of 271.27 g/mol. IUPAC name: sodium 2-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]acetate. InChIKey: LWDJMFONJPJRKJ-UHFFFAOYSA-M.
| Molecular formula | C12H10NNaO3S |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | sodium 2-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]acetate |
| InChIKey | LWDJMFONJPJRKJ-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC(=C1)C2=NC(=CS2)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)