CAS 30582-09-3 is the registry number for Sodium diphenylamine-4-sulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
Sodium 4-anilinobenzenesulfonate (CAS 30582-09-3) is a chemical compound with the molecular formula C12H10NNaO3S and a molecular weight of 271.27 g/mol. IUPAC name: sodium 4-anilinobenzenesulfonate. InChIKey: DGXTZMPQSMIFEC-UHFFFAOYSA-M.
| Molecular formula | C12H10NNaO3S |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | sodium 4-anilinobenzenesulfonate |
| InChIKey | DGXTZMPQSMIFEC-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)