Products 1011464-45-1
CAS 1011464-45-1 is the registry number for Ethyl 2-(5-amino-1-phenyl-1h-pyrazol-3-yl)-2-methylpropanoate, 95%. Offered by: Ambeed. Available pack sizes: 100mg.
Ethyl 2-(5-amino-1-phenylpyrazol-3-yl)-2-methylpropanoate (CAS 1011464-45-1) is a chemical compound with the molecular formula C15H19N3O2 and a molecular weight of 273.33 g/mol. IUPAC name: ethyl 2-(5-amino-1-phenylpyrazol-3-yl)-2-methylpropanoate. InChIKey: LRJAIWZETXCJEO-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O2 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | ethyl 2-(5-amino-1-phenylpyrazol-3-yl)-2-methylpropanoate |
| InChIKey | LRJAIWZETXCJEO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)C1=NN(C(=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)