CAS 1011529-10-4 appears in our catalog under these names: Azvudine, Azvudine/ 99.42% (existing batch purity), 4'-C-Azido-2'-deoxy-2'-fluoro-β-D-arabinocytidine, Azvudine 98%, Azvudine, 98%, 98%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg.
4-amino-1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (CAS 1011529-10-4) is a chemical compound with the molecular formula C9H11FN6O4 and a molecular weight of 286.22 g/mol. IUPAC name: 4-amino-1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: KTOLOIKYVCHRJW-XZMZPDFPSA-N.
| Molecular formula | C9H11FN6O4 |
|---|---|
| Molecular weight | 286.22 g/mol |
| IUPAC name | 4-amino-1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | KTOLOIKYVCHRJW-XZMZPDFPSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@H]([C@@H]([C@](O2)(CO)N=[N+]=[N-])O)F |
Computed by PubChem (NCBI)