CAS 1145869-35-7 is the registry number for Azvudine Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-1-[(2R,3R,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (CAS 1145869-35-7) is a chemical compound with the molecular formula C9H11FN6O4 and a molecular weight of 286.22 g/mol. IUPAC name: 4-amino-1-[(2R,3R,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: KTOLOIKYVCHRJW-JVZYCSMKSA-N.
| Molecular formula | C9H11FN6O4 |
|---|---|
| Molecular weight | 286.22 g/mol |
| IUPAC name | 4-amino-1-[(2R,3R,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | KTOLOIKYVCHRJW-JVZYCSMKSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@](O2)(CO)N=[N+]=[N-])O)F |
Computed by PubChem (NCBI)