CAS 1012-76-6 appears in our catalog under these names: 1,2-Di-tert-butylbenzene, o-Di-tert-butylbenzene. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
1,2-ditert-butylbenzene (CAS 1012-76-6) is a chemical compound with the molecular formula C14H22 and a molecular weight of 190.32 g/mol. IUPAC name: 1,2-ditert-butylbenzene. InChIKey: SZURZHQMGVKJLV-UHFFFAOYSA-N.
| Molecular formula | C14H22 |
|---|---|
| Molecular weight | 190.32 g/mol |
| IUPAC name | 1,2-ditert-butylbenzene |
| InChIKey | SZURZHQMGVKJLV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC=C1C(C)(C)C |
Computed by PubChem (NCBI)