Products 1219799-28-6
CAS 1219799-28-6 appears in our catalog under these names: n-Octylbenzene-d22, 98 atom % D, min 98% Chemical Purity, Octylbenzene–d22, Octylbenzene-d22, 98%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 1g, 0,5g, 10mg, 100mg, 25mg, 50mg, 5 mg, 100 mg.
1,2,3,4,5-pentadeuterio-6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)benzene (CAS 1219799-28-6) is a chemical compound with the molecular formula C14H22 and a molecular weight of 212.46 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)benzene. InChIKey: CDKDZKXSXLNROY-FEGNEZOYSA-N.
| Molecular formula | C14H22 |
|---|---|
| Molecular weight | 212.46 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)benzene |
| InChIKey | CDKDZKXSXLNROY-FEGNEZOYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Octylbenzene-d22