Products 10120-28-2
CAS 10120-28-2 appears in our catalog under these names: Methylcyclohexane-d14, 95%, Methylcyclohexane-d14 (Reagent grade), 99 atom % D, min 99% Chemical Purity, Methylcyclohexane-D14 99,5 atom % D, METHYLCYCLOHEXANE-D14, 99.5 ATOM% D. Offered by: Combi-blocks, CDN, Deutero, Sigma-Aldrich. Available pack sizes: 1g, 5g, 0,7ml, 5ml, 10ml.
1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-(trideuteriomethyl)cyclohexane (CAS 10120-28-2) is a chemical compound with the molecular formula C7H14 and a molecular weight of 112.27 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-(trideuteriomethyl)cyclohexane. InChIKey: UAEPNZWRGJTJPN-OBYKGMMLSA-N.
| Molecular formula | C7H14 |
|---|---|
| Molecular weight | 112.27 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-(trideuteriomethyl)cyclohexane |
| InChIKey | UAEPNZWRGJTJPN-OBYKGMMLSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])C([2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Methylcyclohexane-d14, (2H14)Methylcyclohexane, Cyclohexane-d11, methyl-d3-, [2H14]methylcyclohexane, 1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-(trideuteriomethyl)cyclohexane, Cyclohexane-1,1,2,2,3,3,4,4,5,5,6-d11, 6-(methyl-d3)-, Methylcyclohexane-d14 (reagent grade), Methylcyclohexane-d14 (d, 99.5%), Methylcyclohexane-d??, Methylcyclohexane-d14, 99.5 atom % D