Products 352431-19-7

CAS 352431-19-7 is the registry number for Methylcyclohexane-d11 (ring-d11), 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-methylcyclohexane (CAS 352431-19-7) is a chemical compound with the molecular formula C7H14 and a molecular weight of 109.25 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-methylcyclohexane. InChIKey: UAEPNZWRGJTJPN-QQQWEMTMSA-N.

Identity
Molecular formulaC7H14
Molecular weight109.25 g/mol
IUPAC name1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-methylcyclohexane
InChIKeyUAEPNZWRGJTJPN-QQQWEMTMSA-N
SMILES[2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])C)([2H])[2H])([2H])[2H])[2H]

Computed by PubChem (NCBI)