CAS 352431-19-7 is the registry number for Methylcyclohexane-d11 (ring-d11), 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-methylcyclohexane (CAS 352431-19-7) is a chemical compound with the molecular formula C7H14 and a molecular weight of 109.25 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-methylcyclohexane. InChIKey: UAEPNZWRGJTJPN-QQQWEMTMSA-N.
| Molecular formula | C7H14 |
|---|---|
| Molecular weight | 109.25 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-methylcyclohexane |
| InChIKey | UAEPNZWRGJTJPN-QQQWEMTMSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])C)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)