CAS 1012305-33-7 appears in our catalog under these names: (R)-1-(3-Chloro-4-fluorophenyl)ethanamine, 98+%, (1r)–1–(3–chloro–4–fluoro–phenyl)ethanaMineHCl, (R)-1-(3-Chloro-4-fluorophenyl)ethanamine. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 100mg, 10g, 2g.
(1R)-1-(3-chloro-4-fluorophenyl)ethanamine (CAS 1012305-33-7) is a chemical compound with the molecular formula C8H9ClFN and a molecular weight of 173.61 g/mol. IUPAC name: (1R)-1-(3-chloro-4-fluorophenyl)ethanamine. InChIKey: QHARBBFZGIDKLK-RXMQYKEDSA-N.
| Molecular formula | C8H9ClFN |
|---|---|
| Molecular weight | 173.61 g/mol |
| IUPAC name | (1R)-1-(3-chloro-4-fluorophenyl)ethanamine |
| InChIKey | QHARBBFZGIDKLK-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)F)Cl)N |
Computed by PubChem (NCBI)