CAS 101250-48-0 appears in our catalog under these names: (S)–5–Benzylmorpholin–3–one, (S)-5-Benzylmorpholin-3-one, 97%, 97%, 3-Morpholinone, 5-(phenylmethyl)-, (5S)-, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(5S)-5-benzylmorpholin-3-one (CAS 101250-48-0) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (5S)-5-benzylmorpholin-3-one. InChIKey: PXPFDUZBGQDAEP-JTQLQIEISA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (5S)-5-benzylmorpholin-3-one |
| InChIKey | PXPFDUZBGQDAEP-JTQLQIEISA-N |
| SMILES | C1[C@@H](NC(=O)CO1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)