CAS 101257-84-5 appears in our catalog under these names: 1-Methyl-4-nitro-1H-imidazole-5-sulfonyl chloride, 95%, 1-Methyl-4-nitro-1H-imidazole-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-methyl-5-nitroimidazole-4-sulfonyl chloride (CAS 101257-84-5) is a chemical compound with the molecular formula C4H4ClN3O4S and a molecular weight of 225.61 g/mol. IUPAC name: 3-methyl-5-nitroimidazole-4-sulfonyl chloride. InChIKey: HPQGYIQIVWZUCN-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN3O4S |
|---|---|
| Molecular weight | 225.61 g/mol |
| IUPAC name | 3-methyl-5-nitroimidazole-4-sulfonyl chloride |
| InChIKey | HPQGYIQIVWZUCN-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)