Products 1423033-93-5

CAS 1423033-93-5 appears in our catalog under these names: 1-Methyl-3-nitro-1H-pyrazole-4-sulfonyl chloride, 95%, 1-Methyl-3-nitro-1H-pyrazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

1-methyl-3-nitropyrazole-4-sulfonyl chloride (CAS 1423033-93-5) is a chemical compound with the molecular formula C4H4ClN3O4S and a molecular weight of 225.61 g/mol. IUPAC name: 1-methyl-3-nitropyrazole-4-sulfonyl chloride. InChIKey: ZMXBXTKWTPWLNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4ClN3O4S
Molecular weight225.61 g/mol
IUPAC name1-methyl-3-nitropyrazole-4-sulfonyl chloride
InChIKeyZMXBXTKWTPWLNZ-UHFFFAOYSA-N
SMILESCN1C=C(C(=N1)[N+](=O)[O-])S(=O)(=O)Cl

Computed by PubChem (NCBI)