CAS 101258-09-7 is the registry number for 5,6-Diamino-2-methyl-benzothiazole. Offered by: TRC. Available pack sizes: 500mg.
2-methyl-1,3-benzothiazole-5,6-diamine (CAS 101258-09-7) is a chemical compound with the molecular formula C8H9N3S and a molecular weight of 179.24 g/mol. IUPAC name: 2-methyl-1,3-benzothiazole-5,6-diamine. InChIKey: MROFAQJYRDSJQO-UHFFFAOYSA-N.
| Molecular formula | C8H9N3S |
|---|---|
| Molecular weight | 179.24 g/mol |
| IUPAC name | 2-methyl-1,3-benzothiazole-5,6-diamine |
| InChIKey | MROFAQJYRDSJQO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C(=C2)N)N |
Computed by PubChem (NCBI)