Products 10126-37-1
CAS 10126-37-1 appears in our catalog under these names: 1-(2-Bromo-5-methoxyphenyl)-N,N-dimethylmethanamine, 97%, 2-Bromo-5-methoxy-N,N-dimethylbenzylamine. Offered by: AmBeed, Biosynth. Available pack sizes: 25g, 5g.
1-(2-bromo-5-methoxyphenyl)-N,N-dimethylmethanamine (CAS 10126-37-1) is a chemical compound with the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. IUPAC name: 1-(2-bromo-5-methoxyphenyl)-N,N-dimethylmethanamine. InChIKey: KMYPJJLCQWNEKN-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | 1-(2-bromo-5-methoxyphenyl)-N,N-dimethylmethanamine |
| InChIKey | KMYPJJLCQWNEKN-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=CC(=C1)OC)Br |
Computed by PubChem (NCBI)