CAS 1012793-99-5 is the registry number for 3-(2-Ethoxyethyl)-1-methyl-1H-imidazol-3-ium bromide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-ethoxyethyl)-3-methylimidazol-3-ium bromide (CAS 1012793-99-5) is a chemical compound with the molecular formula C8H15BrN2O and a molecular weight of 235.12 g/mol. IUPAC name: 1-(2-ethoxyethyl)-3-methylimidazol-3-ium bromide. InChIKey: MYUYYHOBINHBCC-UHFFFAOYSA-M.
| Molecular formula | C8H15BrN2O |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 1-(2-ethoxyethyl)-3-methylimidazol-3-ium bromide |
| InChIKey | MYUYYHOBINHBCC-UHFFFAOYSA-M |
| SMILES | CCOCCN1C=C[N+](=C1)C.[Br-] |
Computed by PubChem (NCBI)