Products 1012793-99-5

CAS 1012793-99-5 is the registry number for 3-(2-Ethoxyethyl)-1-methyl-1H-imidazol-3-ium bromide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(2-ethoxyethyl)-3-methylimidazol-3-ium bromide (CAS 1012793-99-5) is a chemical compound with the molecular formula C8H15BrN2O and a molecular weight of 235.12 g/mol. IUPAC name: 1-(2-ethoxyethyl)-3-methylimidazol-3-ium bromide. InChIKey: MYUYYHOBINHBCC-UHFFFAOYSA-M.

Identity
Molecular formulaC8H15BrN2O
Molecular weight235.12 g/mol
IUPAC name1-(2-ethoxyethyl)-3-methylimidazol-3-ium bromide
InChIKeyMYUYYHOBINHBCC-UHFFFAOYSA-M
SMILESCCOCCN1C=C[N+](=C1)C.[Br-]

Computed by PubChem (NCBI)