CAS 1354029-58-5 is the registry number for (S)-2-Amino-1-(3-bromo-piperidin-1-yl)-propan-1-one. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
(2S)-2-amino-1-(3-bromopiperidin-1-yl)propan-1-one (CAS 1354029-58-5) is a chemical compound with the molecular formula C8H15BrN2O and a molecular weight of 235.12 g/mol. IUPAC name: (2S)-2-amino-1-(3-bromopiperidin-1-yl)propan-1-one. InChIKey: JRWWZZRWDJKTBR-PKPIPKONSA-N.
| Molecular formula | C8H15BrN2O |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | (2S)-2-amino-1-(3-bromopiperidin-1-yl)propan-1-one |
| InChIKey | JRWWZZRWDJKTBR-PKPIPKONSA-N |
| SMILES | C[C@@H](C(=O)N1CCCC(C1)Br)N |
Computed by PubChem (NCBI)