CAS 101337-95-5 is the registry number for 8-Chloro-7-fluoro-2H-benzo[b][1,4]thiazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-7-fluoro-4H-1,4-benzothiazin-3-one (CAS 101337-95-5) is a chemical compound with the molecular formula C8H5ClFNOS and a molecular weight of 217.65 g/mol. IUPAC name: 8-chloro-7-fluoro-4H-1,4-benzothiazin-3-one. InChIKey: UZKCXEZQAMGDEX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNOS |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 8-chloro-7-fluoro-4H-1,4-benzothiazin-3-one |
| InChIKey | UZKCXEZQAMGDEX-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)