CAS 1344684-79-2 is the registry number for 2-Chloro-6-fluoro-5-methoxy-1,3-benzothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-6-fluoro-5-methoxy-1,3-benzothiazole (CAS 1344684-79-2) is a chemical compound with the molecular formula C8H5ClFNOS and a molecular weight of 217.65 g/mol. IUPAC name: 2-chloro-6-fluoro-5-methoxy-1,3-benzothiazole. InChIKey: YFOKOXIRXBOQGF-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNOS |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 2-chloro-6-fluoro-5-methoxy-1,3-benzothiazole |
| InChIKey | YFOKOXIRXBOQGF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=C(S2)Cl)F |
Computed by PubChem (NCBI)