CAS 1013643-09-8 appears in our catalog under these names: 7-Bromo-1,3-benzoxazole-2-thiol, 7-Bromobenzo[d]oxazole-2-thiol, ≥97%, ≥97%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg, 5g, 10g.
7-bromo-3H-1,3-benzoxazole-2-thione (CAS 1013643-09-8) is a chemical compound with the molecular formula C7H4BrNOS and a molecular weight of 230.08 g/mol. IUPAC name: 7-bromo-3H-1,3-benzoxazole-2-thione. InChIKey: HQWNPEUAILIPCL-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNOS |
|---|---|
| Molecular weight | 230.08 g/mol |
| IUPAC name | 7-bromo-3H-1,3-benzoxazole-2-thione |
| InChIKey | HQWNPEUAILIPCL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)OC(=S)N2 |
Computed by PubChem (NCBI)