CAS 101413-78-9 appears in our catalog under these names: 4-([(2-Amino-4-oxo-4,5-dihydro-1,3-thiazol-5-yl)acetyl]amino)benzoic acid, 95%, 4-((2-(2-Amino-4,5-dihydro-4-oxo-5-thiazolyl)acetyl)amino)benzoic Acid. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-[[2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetyl]amino]benzoic acid (CAS 101413-78-9) is a chemical compound with the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. IUPAC name: 4-[[2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetyl]amino]benzoic acid. InChIKey: WMNGKZGRTLSGRP-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O4S |
|---|---|
| Molecular weight | 293.30 g/mol |
| IUPAC name | 4-[[2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetyl]amino]benzoic acid |
| InChIKey | WMNGKZGRTLSGRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC(=O)CC2C(=O)N=C(S2)N |
Computed by PubChem (NCBI)