CAS 923138-66-3 is the registry number for 4-((4-sulfamoylphenyl)carbamoyl)pyridine 1-oxide, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
1-oxido-N-(4-sulfamoylphenyl)pyridin-1-ium-4-carboxamide (CAS 923138-66-3) is a chemical compound with the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. IUPAC name: 1-oxido-N-(4-sulfamoylphenyl)pyridin-1-ium-4-carboxamide. InChIKey: TUZLOTSADWGEEY-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O4S |
|---|---|
| Molecular weight | 293.30 g/mol |
| IUPAC name | 1-oxido-N-(4-sulfamoylphenyl)pyridin-1-ium-4-carboxamide |
| InChIKey | TUZLOTSADWGEEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C2=CC=[N+](C=C2)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)