CAS 1014695-50-1 is the registry number for 1-Benzyl-4-piperidinol-2,2,6,6-d4. Offered by: TRC. Available pack sizes: 500mg.
1-benzyl-2,2,6,6-tetradeuteriopiperidin-4-ol (CAS 1014695-50-1) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 195.29 g/mol. IUPAC name: 1-benzyl-2,2,6,6-tetradeuteriopiperidin-4-ol. InChIKey: BPPZXJZYCOETDA-LZMSFWOYSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 195.29 g/mol |
| IUPAC name | 1-benzyl-2,2,6,6-tetradeuteriopiperidin-4-ol |
| InChIKey | BPPZXJZYCOETDA-LZMSFWOYSA-N |
| SMILES | [2H]C1(CC(CC(N1CC2=CC=CC=C2)([2H])[2H])O)[2H] |
Computed by PubChem (NCBI)