Products 88227-11-6
CAS 88227-11-6 is the registry number for 1-Benzyl-4-piperidinol-3,3,5,5-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
1-benzyl-3,3,5,5-tetradeuteriopiperidin-4-ol (CAS 88227-11-6) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 195.29 g/mol. IUPAC name: 1-benzyl-3,3,5,5-tetradeuteriopiperidin-4-ol. InChIKey: BPPZXJZYCOETDA-KXGHAPEVSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 195.29 g/mol |
| IUPAC name | 1-benzyl-3,3,5,5-tetradeuteriopiperidin-4-ol |
| InChIKey | BPPZXJZYCOETDA-KXGHAPEVSA-N |
| SMILES | [2H]C1(CN(CC(C1O)([2H])[2H])CC2=CC=CC=C2)[2H] |
Computed by PubChem (NCBI)