Products 1014696-75-3
CAS 1014696-75-3 is the registry number for Bicifadine-d5 Hydrochloride. Offered by: TRC. Available pack sizes: 10mg, 1mg.
1,2,2,6,6-pentadeuterio-5-(4-methylphenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 1014696-75-3) is a chemical compound with the molecular formula C12H16ClN and a molecular weight of 214.74 g/mol. IUPAC name: 1,2,2,6,6-pentadeuterio-5-(4-methylphenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: OTZOPAFTLUOBOM-MRGWXENESA-N.
| Molecular formula | C12H16ClN |
|---|---|
| Molecular weight | 214.74 g/mol |
| IUPAC name | 1,2,2,6,6-pentadeuterio-5-(4-methylphenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | OTZOPAFTLUOBOM-MRGWXENESA-N |
| SMILES | [2H]C1(C2(C1(CNC2([2H])[2H])C3=CC=C(C=C3)C)[2H])[2H].Cl |
Computed by PubChem (NCBI)
Synonyms:
Bicifadine-d5 Hydrochloride