CAS 66504-82-3 is the registry number for (+)-Bicifadine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 0,5g, 1g, 2g, 5g.
(1R,5S)-1-(4-methylphenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 66504-82-3) is a chemical compound with the molecular formula C12H16ClN and a molecular weight of 209.71 g/mol. IUPAC name: (1R,5S)-1-(4-methylphenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: OTZOPAFTLUOBOM-LYCTWNKOSA-N.
| Molecular formula | C12H16ClN |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | (1R,5S)-1-(4-methylphenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | OTZOPAFTLUOBOM-LYCTWNKOSA-N |
| SMILES | CC1=CC=C(C=C1)[C@@]23C[C@@H]2CNC3.Cl |
Computed by PubChem (NCBI)