Products 10147-50-9
CAS 10147-50-9 is the registry number for racemic Juvenile hormone III acid. Offered by: TRC. Available pack sizes: 10mg, 2,5mg.
(2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoic acid (CAS 10147-50-9) is a chemical compound with the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. IUPAC name: (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoic acid. InChIKey: DIAZNFMKLJLDNM-BFPRWLMKSA-N.
| Molecular formula | C15H24O3 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoic acid |
| InChIKey | DIAZNFMKLJLDNM-BFPRWLMKSA-N |
| SMILES | C/C(=C\CC/C(=C/C(=O)O)/C)/CCC1C(O1)(C)C |
Computed by PubChem (NCBI)