Products 120681-81-4
CAS 120681-81-4 is the registry number for Bisacurone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 0,5mg, 2mg, 10mg, 5 mg, 1 mg.
(6S)-6-[(1R,4S,5S)-4,5-dihydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one (CAS 120681-81-4) is a chemical compound with the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. IUPAC name: (6S)-6-[(1R,4S,5S)-4,5-dihydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one. InChIKey: QJOWFYQIUZMPRY-NEBZKDRISA-N.
| Molecular formula | C15H24O3 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | (6S)-6-[(1R,4S,5S)-4,5-dihydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one |
| InChIKey | QJOWFYQIUZMPRY-NEBZKDRISA-N |
| SMILES | C[C@@H](CC(=O)C=C(C)C)[C@H]1C[C@@H]([C@@](C=C1)(C)O)O |
Computed by PubChem (NCBI)
Synonyms:
bisacurone, orb1683064