CAS 1014712-76-5 appears in our catalog under these names: Endo-7-amino-9-methyl-3-oxa-9-azabicyclo[3.3.1]nonane dihydrochloride, 95%, endo-9-Methyl-3-oxa-9-azabicyclo(3.3.1)nonan-7-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.
(1R,5S)-9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-amine;dihydrochloride (CAS 1014712-76-5) is a chemical compound with the molecular formula C8H18Cl2N2O and a molecular weight of 229.14 g/mol. IUPAC name: (1R,5S)-9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-amine;dihydrochloride. InChIKey: BBOULHJMNLHWEO-KTNFEBOISA-N.
| Molecular formula | C8H18Cl2N2O |
|---|---|
| Molecular weight | 229.14 g/mol |
| IUPAC name | (1R,5S)-9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-amine;dihydrochloride |
| InChIKey | BBOULHJMNLHWEO-KTNFEBOISA-N |
| SMILES | CN1[C@@H]2CC(C[C@H]1COC2)N.Cl.Cl |
Computed by PubChem (NCBI)