CAS 101490-85-1 appears in our catalog under these names: Resorufin beta-d-glucopyranoside, 95%, Resorufin-β-D-glucopyranoside, 97%, Resorufin β–D–glucopyranoside, Resorufin b-D-glucopyranoside, Resorufin Beta-D-glucopyranoside, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 100mg, 1g, 0,01g, 0,005g, 0,025g, 0,05g, 10mg.
7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxazin-3-one (CAS 101490-85-1) is a chemical compound with the molecular formula C18H17NO8 and a molecular weight of 375.3 g/mol. IUPAC name: 7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxazin-3-one. InChIKey: QULZFZMEBOATFS-UYTYNIKBSA-N.
| Molecular formula | C18H17NO8 |
|---|---|
| Molecular weight | 375.3 g/mol |
| IUPAC name | 7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxazin-3-one |
| InChIKey | QULZFZMEBOATFS-UYTYNIKBSA-N |
| SMILES | C1=CC2=C(C=C1O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)OC4=CC(=O)C=CC4=N2 |
Computed by PubChem (NCBI)