CAS 125440-92-8 is the registry number for Resorufin a-D-mannopyranoside. Offered by: Biosynth. Available pack sizes: 5mg, 1mg, 10mg.
7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxazin-3-one (CAS 125440-92-8) is a chemical compound with the molecular formula C18H17NO8 and a molecular weight of 375.3 g/mol. IUPAC name: 7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxazin-3-one. InChIKey: QULZFZMEBOATFS-ZBRFXRBCSA-N.
| Molecular formula | C18H17NO8 |
|---|---|
| Molecular weight | 375.3 g/mol |
| IUPAC name | 7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxazin-3-one |
| InChIKey | QULZFZMEBOATFS-ZBRFXRBCSA-N |
| SMILES | C1=CC2=C(C=C1O[C@@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)OC4=CC(=O)C=CC4=N2 |
Computed by PubChem (NCBI)