Products 101491-79-6
CAS 101491-79-6 appears in our catalog under these names: mAChR antagonist 1, mAChR antagonist 1, 99.59%, mAChR antagonist 1, 99%, 1-Methylpiperidin-4-yl diphenylcarbamate, 99%. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 50 mg, 5 mg, 10 mg.
(1-methylpiperidin-4-yl) N,N-diphenylcarbamate (CAS 101491-79-6) is a chemical compound with the molecular formula C19H22N2O2 and a molecular weight of 310.4 g/mol. IUPAC name: (1-methylpiperidin-4-yl) N,N-diphenylcarbamate. InChIKey: RQDLDNLBJUDOFV-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | (1-methylpiperidin-4-yl) N,N-diphenylcarbamate |
| InChIKey | RQDLDNLBJUDOFV-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)OC(=O)N(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)