CAS 1015167-33-5 is the registry number for Dabigatran Despropionyl Impurity. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-carbamimidoylanilino)methyl]-1-methyl-N-pyridin-2-ylbenzimidazole-5-carboxamide (CAS 1015167-33-5) is a chemical compound with the molecular formula C22H21N7O and a molecular weight of 399.4 g/mol. IUPAC name: 2-[(4-carbamimidoylanilino)methyl]-1-methyl-N-pyridin-2-ylbenzimidazole-5-carboxamide. InChIKey: PCUHMXXHLDGABI-UHFFFAOYSA-N.
| Molecular formula | C22H21N7O |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 2-[(4-carbamimidoylanilino)methyl]-1-methyl-N-pyridin-2-ylbenzimidazole-5-carboxamide |
| InChIKey | PCUHMXXHLDGABI-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(=O)NC3=CC=CC=N3)N=C1CNC4=CC=C(C=C4)C(=N)N |
Computed by PubChem (NCBI)