Products 2499713-65-2
CAS 2499713-65-2 is the registry number for TbPTR1 inhibitor 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[(2,4-diaminopteridin-6-yl)methyl-ethylamino]phenyl]-phenylmethanone (CAS 2499713-65-2) is a chemical compound with the molecular formula C22H21N7O and a molecular weight of 399.4 g/mol. IUPAC name: [4-[(2,4-diaminopteridin-6-yl)methyl-ethylamino]phenyl]-phenylmethanone. InChIKey: ASBJYAZYFSRQAB-UHFFFAOYSA-N.
| Molecular formula | C22H21N7O |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | [4-[(2,4-diaminopteridin-6-yl)methyl-ethylamino]phenyl]-phenylmethanone |
| InChIKey | ASBJYAZYFSRQAB-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
TbPTR1 inhibitor 1, orb1688127