CAS 1015525-16-2 is the registry number for [1-(4-Fluorophenyl)-3,5-dimethyl-1h-pyrazol-4-yl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanol (CAS 1015525-16-2) is a chemical compound with the molecular formula C12H13FN2O and a molecular weight of 220.24 g/mol. IUPAC name: [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanol. InChIKey: AMEJWZHXFGFEHG-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2O |
|---|---|
| Molecular weight | 220.24 g/mol |
| IUPAC name | [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanol |
| InChIKey | AMEJWZHXFGFEHG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)F)C)CO |
Computed by PubChem (NCBI)