CAS 1483306-79-1 is the registry number for 1-[(3-Fluorophenyl)methyl]-3,5-dimethyl-1h-pyrazol-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-ol (CAS 1483306-79-1) is a chemical compound with the molecular formula C12H13FN2O and a molecular weight of 220.24 g/mol. IUPAC name: 1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-ol. InChIKey: HGTVZLSDQMBWQF-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2O |
|---|---|
| Molecular weight | 220.24 g/mol |
| IUPAC name | 1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-ol |
| InChIKey | HGTVZLSDQMBWQF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC(=CC=C2)F)C)O |
Computed by PubChem (NCBI)