Products 1015846-18-0
CAS 1015846-18-0 is the registry number for 4-(4-Methoxyphenyl)-1,3-dimethyl-1h-pyrazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
4-(4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine (CAS 1015846-18-0) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. IUPAC name: 4-(4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine. InChIKey: QAFSLXFLSQXIIG-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-1,3-dimethylpyrazol-5-amine |
| InChIKey | QAFSLXFLSQXIIG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C2=CC=C(C=C2)OC)N)C |
Computed by PubChem (NCBI)