Products 1015894-22-0

CAS 1015894-22-0 is the registry number for 3,5-Diethyl 1-(2-oxopropyl)pyrazole-3,5-dicarboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Diethyl 1-(2-oxopropyl)pyrazole-3,5-dicarboxylate (CAS 1015894-22-0) is a chemical compound with the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. IUPAC name: diethyl 1-(2-oxopropyl)pyrazole-3,5-dicarboxylate. InChIKey: JKXSKJQHYGBMCX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16N2O5
Molecular weight268.27 g/mol
IUPAC namediethyl 1-(2-oxopropyl)pyrazole-3,5-dicarboxylate
InChIKeyJKXSKJQHYGBMCX-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=NN1CC(=O)C)C(=O)OCC

Computed by PubChem (NCBI)