CAS 877671-39-1 is the registry number for N-BOC-3-Methoxy-4-nitroaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl N-(3-methoxy-4-nitrophenyl)carbamate (CAS 877671-39-1) is a chemical compound with the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. IUPAC name: tert-butyl N-(3-methoxy-4-nitrophenyl)carbamate. InChIKey: PIHXKPLPECCTDC-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O5 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | tert-butyl N-(3-methoxy-4-nitrophenyl)carbamate |
| InChIKey | PIHXKPLPECCTDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)