CAS 1015937-56-0 appears in our catalog under these names: 3,5-Diiodosalicylic acid potassium salt, 95%, Potassium 3,5–Diiodosalicylate, Potassium 3,5-Diiodosalicylate, >97.0%(T), Potassium 2-hydroxy-3,5-diiodobenzoate, 97%, 97%, Potassium 2-carboxy-4,6-diiodophenolate, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 200mg, 5g, 100mg.
Potassium 2-hydroxy-3,5-diiodobenzoate (CAS 1015937-56-0) is a chemical compound with the molecular formula C7H3I2KO3 and a molecular weight of 428.00 g/mol. IUPAC name: potassium 2-hydroxy-3,5-diiodobenzoate. InChIKey: SNHIVWOGVZUVLO-UHFFFAOYSA-M.
| Molecular formula | C7H3I2KO3 |
|---|---|
| Molecular weight | 428.00 g/mol |
| IUPAC name | potassium 2-hydroxy-3,5-diiodobenzoate |
| InChIKey | SNHIVWOGVZUVLO-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1C(=O)[O-])O)I)I.[K+] |
Computed by PubChem (NCBI)