CAS 17274-17-8 appears in our catalog under these names: Sodium 2-hydroxy-3,5-diiodobenzoate, 95%, Sodium 2-hydroxy-3,5-diiodobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Potassium 2-hydroxy-3,5-diiodobenzoate (CAS 17274-17-8) is a chemical compound with the molecular formula C7H3I2KO3 and a molecular weight of 428.00 g/mol. IUPAC name: potassium 2-hydroxy-3,5-diiodobenzoate. InChIKey: SNHIVWOGVZUVLO-UHFFFAOYSA-M.
| Molecular formula | C7H3I2KO3 |
|---|---|
| Molecular weight | 428.00 g/mol |
| IUPAC name | potassium 2-hydroxy-3,5-diiodobenzoate |
| InChIKey | SNHIVWOGVZUVLO-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1C(=O)[O-])O)I)I.[K+] |
Computed by PubChem (NCBI)