CAS 1016-60-0 appears in our catalog under these names: 1-(3,5,7-Trimethyl-1-benzothiophen-2-yl)ethan-1-one, 95%, 1-(3,5,7-Trimethyl-1-benzothiophen-2-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(3,5,7-trimethyl-1-benzothiophen-2-yl)ethanone (CAS 1016-60-0) is a chemical compound with the molecular formula C13H14OS and a molecular weight of 218.32 g/mol. IUPAC name: 1-(3,5,7-trimethyl-1-benzothiophen-2-yl)ethanone. InChIKey: UTXTVLXQRMVZQV-UHFFFAOYSA-N.
| Molecular formula | C13H14OS |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 1-(3,5,7-trimethyl-1-benzothiophen-2-yl)ethanone |
| InChIKey | UTXTVLXQRMVZQV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=C(S2)C(=O)C)C)C |
Computed by PubChem (NCBI)