CAS 1248793-29-4 is the registry number for (3,4-Dimethylphenyl)(thiophen-2-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3,4-dimethylphenyl)-thiophen-2-ylmethanol (CAS 1248793-29-4) is a chemical compound with the molecular formula C13H14OS and a molecular weight of 218.32 g/mol. IUPAC name: (3,4-dimethylphenyl)-thiophen-2-ylmethanol. InChIKey: UXEJWIZVTUBBTK-UHFFFAOYSA-N.
| Molecular formula | C13H14OS |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | (3,4-dimethylphenyl)-thiophen-2-ylmethanol |
| InChIKey | UXEJWIZVTUBBTK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C2=CC=CS2)O)C |
Computed by PubChem (NCBI)